About 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide
2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide (PubChem CID 156904665) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide |
| PubChem CID | 156904665 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide |
| SMILES | COc1ccc(C2OCC(C)(C)C(C(N)=O)O2)cc1 |
| InChI | InChI=1S/C14H19NO4/c1-14(2)8-18-13(19-11(14)12(15)16)9-4-6-10(17-3)7-5-9/h4-7,11,13H,8H2,1-3H3,(H2,15,16) |
| InChIKey | ADKXBIHASVQNPE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide?
The IUPAC name of 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide (CID 156904665) is 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide.
What is the SMILES notation for 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide?
The canonical SMILES for 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide is COc1ccc(C2OCC(C)(C)C(C(N)=O)O2)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide?
The InChIKey is ADKXBIHASVQNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-14(2)8-18-13(19-11(14)12(15)16)9-4-6-10(17-3)7-5-9/h4-7,11,13H,8H2,1-3H3,(H2,15,16).
What are the key properties of 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide?
2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide has a molecular weight of 265.31 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane-4-carboxamide is sourced from PubChem (CID 156904665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).