C27H28N2O6S2 — CID 156904790
1-benzylsulfonyl-N,N-bis[(4-methoxyphenyl)methyl]pyrrole-3-sulfonamide (PubChem CID 156904790) has the molecular formula C27H28N2O6S2 and a molecular weight of 540.66 g/mol. Its IUPAC name is 1-benzylsulfonyl-N,N-bis[(4-methoxyphenyl)methyl]pyrrole-3-sulfonamide.
| Compound Name | 1-benzylsulfonyl-N,N-bis[(4-methoxyphenyl)methyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 156904790 |
| Molecular Formula | C27H28N2O6S2 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 1-benzylsulfonyl-N,N-bis[(4-methoxyphenyl)methyl]pyrrole-3-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2ccn(S(=O)(=O)Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H28N2O6S2/c1-34-25-12-8-22(9-13-25)18-29(19-23-10-14-26(35-2)15-11-23)37(32,33)27-16-17-28(20-27)36(30,31)21-24-6-4-3-5-7-24/h3-17,20H,18-19,21H2,1-2H3 |
| InChIKey | HIGCHIIZCOTORM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |