C13H18BNO5S — CID 156905167
[(1R)-1-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]-2-thiophen-3-ylethoxy]boronic acid (PubChem CID 156905167) has the molecular formula C13H18BNO5S and a molecular weight of 311.17 g/mol. Its IUPAC name is [(1R)-1-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]-2-thiophen-3-ylethoxy]boronic acid.
| Compound Name | [(1R)-1-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]-2-thiophen-3-ylethoxy]boronic acid |
|---|---|
| PubChem CID | 156905167 |
| Molecular Formula | C13H18BNO5S |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | [(1R)-1-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]-2-thiophen-3-ylethoxy]boronic acid |
| SMILES | O=C(N[C@@H](Cc1ccsc1)OB(O)O)[C@@H]1C[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C13H18BNO5S/c16-13(10-6-9-1-2-11(10)19-9)15-12(20-14(17)18)5-8-3-4-21-7-8/h3-4,7,9-12,17-18H,1-2,5-6H2,(H,15,16)/t9-,10-,11+,12-/m1/s1 |
| InChIKey | IOELXJFOLRBJHP-WISYIIOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|