About 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide
2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide (PubChem CID 156905309) has the molecular formula C6H5FN2O2S
and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 156905309 |
| Molecular Formula | C6H5FN2O2S |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide |
| SMILES | NC(=O)Cc1nc(F)c(C=O)s1 |
| InChI | InChI=1S/C6H5FN2O2S/c7-6-3(2-10)12-5(9-6)1-4(8)11/h2H,1H2,(H2,8,11) |
| InChIKey | TXOSONAPQKPAJC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide (CID 156905309) is 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide is NC(=O)Cc1nc(F)c(C=O)s1.
What is the InChIKey of 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is TXOSONAPQKPAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2O2S/c7-6-3(2-10)12-5(9-6)1-4(8)11/h2H,1H2,(H2,8,11).
What are the key properties of 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide?
2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 188.18 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-5-formyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 156905309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).