C11H10N4OS — CID 156905620
5-[2-(benzimidazol-1-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 156905620) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 5-[2-(benzimidazol-1-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(benzimidazol-1-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 156905620 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-[2-(benzimidazol-1-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(CCn2cnc3ccccc32)o1 |
| InChI | InChI=1S/C11H10N4OS/c17-11-14-13-10(16-11)5-6-15-7-12-8-3-1-2-4-9(8)15/h1-4,7H,5-6H2,(H,14,17) |
| InChIKey | FPLUKGYEDOXCFZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|