C20H36N2 — CID 156905654
7-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]-3-azabicyclo[3.3.1]non-6-ene (PubChem CID 156905654) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 7-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]-3-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 7-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]-3-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 156905654 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 7-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]-3-azabicyclo[3.3.1]non-6-ene |
| SMILES | CC1(C)CCCC(C)(C)N1CCCC1=CC2CNCC(C1)C2 |
| InChI | InChI=1S/C20H36N2/c1-19(2)8-6-9-20(3,4)22(19)10-5-7-16-11-17-13-18(12-16)15-21-14-17/h11,17-18,21H,5-10,12-15H2,1-4H3 |
| InChIKey | ZANBVPDDPCSEQC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|