C20H37NO2 — CID 156905664
[(1R,5S)-5-(hydroxymethyl)-3-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]cyclohex-3-en-1-yl]methanol (PubChem CID 156905664) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is [(1R,5S)-5-(hydroxymethyl)-3-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]cyclohex-3-en-1-yl]methanol.
| Compound Name | [(1R,5S)-5-(hydroxymethyl)-3-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]cyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 156905664 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | [(1R,5S)-5-(hydroxymethyl)-3-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]cyclohex-3-en-1-yl]methanol |
| SMILES | CC1(C)CCCC(C)(C)N1CCCC1=C[C@@H](CO)C[C@@H](CO)C1 |
| InChI | InChI=1S/C20H37NO2/c1-19(2)8-6-9-20(3,4)21(19)10-5-7-16-11-17(14-22)13-18(12-16)15-23/h11,17-18,22-23H,5-10,12-15H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | MXQYOONKLVVFHN-MSOLQXFVSA-N |
| XLogP | 3.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|