About 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone
2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone (PubChem CID 156905709) has the molecular formula C23H16ClN3O2
and a molecular weight of 401.85 g/mol. Its IUPAC name is 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone.
Molecular Properties
| Compound Name | 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone |
| PubChem CID | 156905709 |
| Molecular Formula | C23H16ClN3O2 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cn2c3ccc(Cl)cc3c3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C23H16ClN3O2/c1-29-16-9-6-14(7-10-16)21(28)13-27-20-11-8-15(24)12-17(20)22-23(27)26-19-5-3-2-4-18(19)25-22/h2-12H,13H2,1H3 |
| InChIKey | NKVYCDFWMSMEHD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone?
The IUPAC name of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone (CID 156905709) is 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone.
What is the SMILES notation for 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone?
The canonical SMILES for 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone is COc1ccc(C(=O)Cn2c3ccc(Cl)cc3c3nc4ccccc4nc32)cc1.
What is the InChIKey of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone?
The InChIKey is NKVYCDFWMSMEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16ClN3O2/c1-29-16-9-6-14(7-10-16)21(28)13-27-20-11-8-15(24)12-17(20)22-23(27)26-19-5-3-2-4-18(19)25-22/h2-12H,13H2,1H3.
What are the key properties of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone?
2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone has a molecular weight of 401.85 g/mol, XLogP of 5.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)-1-(4-methoxyphenyl)ethanone is sourced from PubChem (CID 156905709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).