C15H13Cl3N4O3 — CID 156905880
6-[4-(3,4,5-trichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 156905880) has the molecular formula C15H13Cl3N4O3 and a molecular weight of 403.65 g/mol. Its IUPAC name is 6-[4-(3,4,5-trichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[4-(3,4,5-trichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156905880 |
| Molecular Formula | C15H13Cl3N4O3 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 6-[4-(3,4,5-trichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CCN(c2cc(Cl)c(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H13Cl3N4O3/c16-9-5-8(6-10(17)13(9)18)21-1-3-22(4-2-21)14(24)11-7-12(23)20-15(25)19-11/h5-7H,1-4H2,(H2,19,20,23,25) |
| InChIKey | BYGXXTSBJDGVES-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|