C28H29N3O4 — CID 156905904
N-[(4R,4aS,7R,12bS)-3-cyclopropyl-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1H-indole-3-carboxamide (PubChem CID 156905904) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[(4R,4aS,7R,12bS)-3-cyclopropyl-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1H-indole-3-carboxamide.
| Compound Name | N-[(4R,4aS,7R,12bS)-3-cyclopropyl-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 156905904 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[(4R,4aS,7R,12bS)-3-cyclopropyl-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1H-indole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C2CC2)C1O5)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H29N3O4/c32-21-8-5-15-13-22-28(34)10-9-20(30-26(33)18-14-29-19-4-2-1-3-17(18)19)25-27(28,23(15)24(21)35-25)11-12-31(22)16-6-7-16/h1-5,8,14,16,20,22,25,29,32,34H,6-7,9-13H2,(H,30,33)/t20-,22-,25?,27+,28-/m1/s1 |
| InChIKey | GSLHHTGKNGSUME-CEEPHLTLSA-N |
| XLogP | 2.99 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |