C13H16ClFN2O3S — CID 156906193
2-chloro-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone (PubChem CID 156906193) has the molecular formula C13H16ClFN2O3S and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-chloro-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 156906193 |
| Molecular Formula | C13H16ClFN2O3S |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-chloro-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(CCl)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C13H16ClFN2O3S/c14-10-13(18)16-6-1-7-17(9-8-16)21(19,20)12-4-2-11(15)3-5-12/h2-5H,1,6-10H2 |
| InChIKey | FSSOUDWKRDPMFL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|