About chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide
chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide (PubChem CID 156907237) has the molecular formula C11H21AuClN2-
and a molecular weight of 413.72 g/mol. Its IUPAC name is chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide.
Molecular Properties
| Compound Name | chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide |
| PubChem CID | 156907237 |
| Molecular Formula | C11H21AuClN2- |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[CH-]1.Cl[Au] |
| InChI | InChI=1S/C11H21N2.Au.ClH/c1-10(2,3)12-7-8-13(9-12)11(4,5)6;;/h7-9H,1-6H3;;1H/q-1;+1;/p-1 |
| InChIKey | XVDJEZXWWVBOGH-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide?
The IUPAC name of chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide (CID 156907237) is chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide.
What is the SMILES notation for chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide?
The canonical SMILES for chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide is CC(C)(C)N1C=CN(C(C)(C)C)[CH-]1.Cl[Au].
What is the InChIKey of chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide?
The InChIKey is XVDJEZXWWVBOGH-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H21N2.Au.ClH/c1-10(2,3)12-7-8-13(9-12)11(4,5)6;;/h7-9H,1-6H3;;1H/q-1;+1;/p-1.
What are the key properties of chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide?
chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide has a molecular weight of 413.72 g/mol, XLogP of 3.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorogold;1,3-ditert-butyl-2H-imidazol-2-ide is sourced from PubChem (CID 156907237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).