C18H7Cl7O6S — CID 156907363
[4-[2-chloro-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate (PubChem CID 156907363) has the molecular formula C18H7Cl7O6S and a molecular weight of 599.49 g/mol. Its IUPAC name is [4-[2-chloro-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate.
| Compound Name | [4-[2-chloro-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate |
|---|---|
| PubChem CID | 156907363 |
| Molecular Formula | C18H7Cl7O6S |
| Molecular Weight | 599.49 g/mol |
| Exact Mass | 595.78 |
| IUPAC Name | [4-[2-chloro-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate |
| SMILES | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(Cl)=C(Cl)Cl)cc2Cl)cc1)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C18H7Cl7O6S/c19-11-7-9(31-18(27)14(21)16(24)25)3-6-12(11)32(28,29)10-4-1-8(2-5-10)30-17(26)13(20)15(22)23/h1-7H |
| InChIKey | DLLSAOIDLYMPGN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|