C19H21N5O — CID 156907771
6-propan-2-yl-5-(4-pyridin-4-ylphenyl)-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 156907771) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-propan-2-yl-5-(4-pyridin-4-ylphenyl)-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-propan-2-yl-5-(4-pyridin-4-ylphenyl)-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 156907771 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 6-propan-2-yl-5-(4-pyridin-4-ylphenyl)-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CC(C)C1=C(c2ccc(-c3ccncc3)cc2)NC2NCNN2C1=O |
| InChI | InChI=1S/C19H21N5O/c1-12(2)16-17(23-19-21-11-22-24(19)18(16)25)15-5-3-13(4-6-15)14-7-9-20-10-8-14/h3-10,12,19,21-23H,11H2,1-2H3 |
| InChIKey | WLIOGJQUOQTVFZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |