C14H16F3N5O — CID 156907803
6-propan-2-yl-5-[6-(trifluoromethyl)-3-pyridinyl]-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 156907803) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is 6-propan-2-yl-5-[6-(trifluoromethyl)-3-pyridinyl]-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-propan-2-yl-5-[6-(trifluoromethyl)-3-pyridinyl]-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 156907803 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 6-propan-2-yl-5-[6-(trifluoromethyl)-3-pyridinyl]-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CC(C)C1=C(c2ccc(C(F)(F)F)nc2)NC2NCNN2C1=O |
| InChI | InChI=1S/C14H16F3N5O/c1-7(2)10-11(21-13-19-6-20-22(13)12(10)23)8-3-4-9(18-5-8)14(15,16)17/h3-5,7,13,19-21H,6H2,1-2H3 |
| InChIKey | CIDAUWFGYLUROC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |