C24H29F3N6O2 — CID 156907852
3-cyclopropyl-6-[(5-methoxy-2-pyridinyl)methyl]-1-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]propyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 156907852) has the molecular formula C24H29F3N6O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 3-cyclopropyl-6-[(5-methoxy-2-pyridinyl)methyl]-1-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]propyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 3-cyclopropyl-6-[(5-methoxy-2-pyridinyl)methyl]-1-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]propyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 156907852 |
| Molecular Formula | C24H29F3N6O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 3-cyclopropyl-6-[(5-methoxy-2-pyridinyl)methyl]-1-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]propyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CC[C@@H](c1ccc(C(F)(F)F)nc1)N1NC(C2CC2)C2C(=O)NC(Cc3ccc(OC)cn3)NC21 |
| InChI | InChI=1S/C24H29F3N6O2/c1-3-17(14-6-9-18(29-11-14)24(25,26)27)33-22-20(21(32-33)13-4-5-13)23(34)31-19(30-22)10-15-7-8-16(35-2)12-28-15/h6-9,11-13,17,19-22,30,32H,3-5,10H2,1-2H3,(H,31,34)/t17-,19?,20?,21?,22?/m0/s1 |
| InChIKey | MHNMAHJIPMBNDE-DTJKJAFUSA-N |
| XLogP | 2.78 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |