C15H24N5O3+ — CID 156907868
7-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 156907868) has the molecular formula C15H24N5O3+ and a molecular weight of 322.39 g/mol. Its IUPAC name is 7-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 156907868 |
| Molecular Formula | C15H24N5O3+ |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 7-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CCC[C@H]2NCCC[C@@H]2O)N(C)C1=O |
| InChI | InChI=1S/C15H24N5O3/c1-18-13-12(14(22)19(2)15(18)23)20(9-17-13)8-4-5-10-11(21)6-3-7-16-10/h9-12,16,21H,3-8H2,1-2H3/q+1/t10-,11+,12?/m1/s1 |
| InChIKey | QLGRNMLOWQGHTI-UBNQGINQSA-N |
| XLogP | -0.78 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|