C23H42NO4+ — CID 156908016
[(2R)-3-carboxy-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl]-trimethylazanium (PubChem CID 156908016) has the molecular formula C23H42NO4+ and a molecular weight of 396.59 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156908016 |
| Molecular Formula | C23H42NO4+ |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | [(2R)-3-carboxy-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl]-trimethylazanium |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C23H41NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(27)28-21(19-22(25)26)20-24(2,3)4/h7-8,10-11,21H,5-6,9,12-20H2,1-4H3/p+1/b8-7-,11-10-/t21-/m1/s1 |
| InChIKey | CMVGCHSJDXKPBB-ROVXQSMVSA-O |
| XLogP | 5.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|