C15H22N2O3 — CID 15690944
[(1S,2S,9aR)-2-hydroxy-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1H-pyrrole-2-carboxylate (PubChem CID 15690944) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is [(1S,2S,9aR)-2-hydroxy-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1H-pyrrole-2-carboxylate.
| Compound Name | [(1S,2S,9aR)-2-hydroxy-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 15690944 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [(1S,2S,9aR)-2-hydroxy-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OC[C@@H]1[C@H]2CCCCN2CC[C@@H]1O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H22N2O3/c18-14-6-9-17-8-2-1-5-13(17)11(14)10-20-15(19)12-4-3-7-16-12/h3-4,7,11,13-14,16,18H,1-2,5-6,8-10H2/t11-,13-,14+/m1/s1 |
| InChIKey | GQFADDIPDZRRSX-BNOWGMLFSA-N |
| XLogP | 1.41 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |