About 3,4,5,6-tetrachlorocyclohexene
3,4,5,6-tetrachlorocyclohexene (PubChem CID 15691) has the molecular formula C6H6Cl4
and a molecular weight of 219.93 g/mol. Its IUPAC name is 3,4,5,6-tetrachlorocyclohexene.
Molecular Properties
| Compound Name | 3,4,5,6-tetrachlorocyclohexene |
| PubChem CID | 15691 |
| Molecular Formula | C6H6Cl4 |
| Molecular Weight | 219.93 g/mol |
| Exact Mass | 217.92 |
| IUPAC Name | 3,4,5,6-tetrachlorocyclohexene |
| SMILES | ClC1C=CC(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C6H6Cl4/c7-3-1-2-4(8)6(10)5(3)9/h1-6H |
| InChIKey | CHTOKGBXCBVHQO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.93 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5,6-tetrachlorocyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5,6-tetrachlorocyclohexene?
The IUPAC name of 3,4,5,6-tetrachlorocyclohexene (CID 15691) is 3,4,5,6-tetrachlorocyclohexene.
What is the SMILES notation for 3,4,5,6-tetrachlorocyclohexene?
The canonical SMILES for 3,4,5,6-tetrachlorocyclohexene is ClC1C=CC(Cl)C(Cl)C1Cl.
What is the InChIKey of 3,4,5,6-tetrachlorocyclohexene?
The InChIKey is CHTOKGBXCBVHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl4/c7-3-1-2-4(8)6(10)5(3)9/h1-6H.
What are the key properties of 3,4,5,6-tetrachlorocyclohexene?
3,4,5,6-tetrachlorocyclohexene has a molecular weight of 219.93 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,6-tetrachlorocyclohexene is sourced from PubChem (CID 15691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).