About ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate
ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate (PubChem CID 15691767) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate |
| PubChem CID | 15691767 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2nc(O)c(C)s2)cc1 |
| InChI | InChI=1S/C13H13NO3S/c1-3-17-13(16)10-6-4-9(5-7-10)12-14-11(15)8(2)18-12/h4-7,15H,3H2,1-2H3 |
| InChIKey | MHNVFOGDZKNSRC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate?
The IUPAC name of ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate (CID 15691767) is ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate.
What is the SMILES notation for ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate?
The canonical SMILES for ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate is CCOC(=O)c1ccc(-c2nc(O)c(C)s2)cc1.
What is the InChIKey of ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate?
The InChIKey is MHNVFOGDZKNSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-3-17-13(16)10-6-4-9(5-7-10)12-14-11(15)8(2)18-12/h4-7,15H,3H2,1-2H3.
What are the key properties of ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate?
ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate has a molecular weight of 263.32 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate is sourced from PubChem (CID 15691767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).