About 4-butylimino-5,5-diethylfuran-2-amine
4-butylimino-5,5-diethylfuran-2-amine (PubChem CID 15692040) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-butylimino-5,5-diethylfuran-2-amine.
Molecular Properties
| Compound Name | 4-butylimino-5,5-diethylfuran-2-amine |
| PubChem CID | 15692040 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 4-butylimino-5,5-diethylfuran-2-amine |
| SMILES | CCCC/N=C1\C=C(N)OC1(CC)CC |
| InChI | InChI=1S/C12H22N2O/c1-4-7-8-14-10-9-11(13)15-12(10,5-2)6-3/h9H,4-8,13H2,1-3H3/b14-10+ |
| InChIKey | YFHGCLUWVGNFHY-GXDHUFHOSA-N |
| XLogP | 2.62 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-butylimino-5,5-diethylfuran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylimino-5,5-diethylfuran-2-amine?
The IUPAC name of 4-butylimino-5,5-diethylfuran-2-amine (CID 15692040) is 4-butylimino-5,5-diethylfuran-2-amine.
What is the SMILES notation for 4-butylimino-5,5-diethylfuran-2-amine?
The canonical SMILES for 4-butylimino-5,5-diethylfuran-2-amine is CCCC/N=C1\C=C(N)OC1(CC)CC.
What is the InChIKey of 4-butylimino-5,5-diethylfuran-2-amine?
The InChIKey is YFHGCLUWVGNFHY-GXDHUFHOSA-N. The full InChI is InChI=1S/C12H22N2O/c1-4-7-8-14-10-9-11(13)15-12(10,5-2)6-3/h9H,4-8,13H2,1-3H3/b14-10+.
What are the key properties of 4-butylimino-5,5-diethylfuran-2-amine?
4-butylimino-5,5-diethylfuran-2-amine has a molecular weight of 210.32 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylimino-5,5-diethylfuran-2-amine is sourced from PubChem (CID 15692040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).