About 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one
2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 15692399) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one |
| PubChem CID | 15692399 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | NCCO.O=c1cccccc1O |
| InChI | InChI=1S/C7H6O2.C2H7NO/c8-6-4-2-1-3-5-7(6)9;3-1-2-4/h1-5H,(H,8,9);4H,1-3H2 |
| InChIKey | YFLFLLBVTNOUSQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one (CID 15692399) is 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one is NCCO.O=c1cccccc1O.
What is the InChIKey of 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one?
The InChIKey is YFLFLLBVTNOUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H7NO/c8-6-4-2-1-3-5-7(6)9;3-1-2-4/h1-5H,(H,8,9);4H,1-3H2.
What are the key properties of 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one?
2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one has a molecular weight of 183.21 g/mol, XLogP of -0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-hydroxycyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 15692399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).