About 3-methylsulfanylaniline
3-methylsulfanylaniline (PubChem CID 15693) has the molecular formula C7H9NS
and a molecular weight of 139.22 g/mol. Its IUPAC name is 3-methylsulfanylaniline.
Molecular Properties
| Compound Name | 3-methylsulfanylaniline |
| PubChem CID | 15693 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 3-methylsulfanylaniline |
| SMILES | CSc1cccc(N)c1 |
| InChI | InChI=1S/C7H9NS/c1-9-7-4-2-3-6(8)5-7/h2-5H,8H2,1H3 |
| InChIKey | KCHLDNLIJVSRPK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylaniline?
The IUPAC name of 3-methylsulfanylaniline (CID 15693) is 3-methylsulfanylaniline.
What is the SMILES notation for 3-methylsulfanylaniline?
The canonical SMILES for 3-methylsulfanylaniline is CSc1cccc(N)c1.
What is the InChIKey of 3-methylsulfanylaniline?
The InChIKey is KCHLDNLIJVSRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS/c1-9-7-4-2-3-6(8)5-7/h2-5H,8H2,1H3.
What are the key properties of 3-methylsulfanylaniline?
3-methylsulfanylaniline has a molecular weight of 139.22 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylaniline is sourced from PubChem (CID 15693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).