About 2,4,7-trimethoxyphenanthrene
2,4,7-trimethoxyphenanthrene (PubChem CID 15693458) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is 2,4,7-trimethoxyphenanthrene.
Molecular Properties
| Compound Name | 2,4,7-trimethoxyphenanthrene |
| PubChem CID | 15693458 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2,4,7-trimethoxyphenanthrene |
| SMILES | COc1ccc2c(ccc3cc(OC)cc(OC)c32)c1 |
| InChI | InChI=1S/C17H16O3/c1-18-13-6-7-15-11(8-13)4-5-12-9-14(19-2)10-16(20-3)17(12)15/h4-10H,1-3H3 |
| InChIKey | XMQKMUPVLZWRKF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,4,7-trimethoxyphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,7-trimethoxyphenanthrene?
The IUPAC name of 2,4,7-trimethoxyphenanthrene (CID 15693458) is 2,4,7-trimethoxyphenanthrene.
What is the SMILES notation for 2,4,7-trimethoxyphenanthrene?
The canonical SMILES for 2,4,7-trimethoxyphenanthrene is COc1ccc2c(ccc3cc(OC)cc(OC)c32)c1.
What is the InChIKey of 2,4,7-trimethoxyphenanthrene?
The InChIKey is XMQKMUPVLZWRKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-18-13-6-7-15-11(8-13)4-5-12-9-14(19-2)10-16(20-3)17(12)15/h4-10H,1-3H3.
What are the key properties of 2,4,7-trimethoxyphenanthrene?
2,4,7-trimethoxyphenanthrene has a molecular weight of 268.31 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,7-trimethoxyphenanthrene is sourced from PubChem (CID 15693458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).