About 2,4,7-trimethoxy-9,10-dihydrophenanthrene
2,4,7-trimethoxy-9,10-dihydrophenanthrene (PubChem CID 15693459) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2,4,7-trimethoxy-9,10-dihydrophenanthrene.
Molecular Properties
| Compound Name | 2,4,7-trimethoxy-9,10-dihydrophenanthrene |
| PubChem CID | 15693459 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2,4,7-trimethoxy-9,10-dihydrophenanthrene |
| SMILES | COc1ccc2c(c1)CCc1cc(OC)cc(OC)c1-2 |
| InChI | InChI=1S/C17H18O3/c1-18-13-6-7-15-11(8-13)4-5-12-9-14(19-2)10-16(20-3)17(12)15/h6-10H,4-5H2,1-3H3 |
| InChIKey | GKXBCRATDFSQOD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4,7-trimethoxy-9,10-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,7-trimethoxy-9,10-dihydrophenanthrene?
The IUPAC name of 2,4,7-trimethoxy-9,10-dihydrophenanthrene (CID 15693459) is 2,4,7-trimethoxy-9,10-dihydrophenanthrene.
What is the SMILES notation for 2,4,7-trimethoxy-9,10-dihydrophenanthrene?
The canonical SMILES for 2,4,7-trimethoxy-9,10-dihydrophenanthrene is COc1ccc2c(c1)CCc1cc(OC)cc(OC)c1-2.
What is the InChIKey of 2,4,7-trimethoxy-9,10-dihydrophenanthrene?
The InChIKey is GKXBCRATDFSQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3/c1-18-13-6-7-15-11(8-13)4-5-12-9-14(19-2)10-16(20-3)17(12)15/h6-10H,4-5H2,1-3H3.
What are the key properties of 2,4,7-trimethoxy-9,10-dihydrophenanthrene?
2,4,7-trimethoxy-9,10-dihydrophenanthrene has a molecular weight of 270.33 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,7-trimethoxy-9,10-dihydrophenanthrene is sourced from PubChem (CID 15693459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).