(3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid

C10H16O3 — CID 15693863

IUPAC(3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid
SMILESCC1=C(C(=O)O)C(C)(C)CC[C@H]1O
InChIInChI=1S/C10H16O3/c1-6-7(11)4-5-10(2,3)8(6)9(12)13/h7,11H,4-5H2,1-3H3,(H,12,13)/t7-/m1/s1
InChIKeyIJTFWVKHFTZVSR-SSDOTTSWSA-N
MW184.23 g/mol
LogP1.57
Rot. Bonds1

About (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid

(3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid (PubChem CID 15693863) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid.

Molecular Properties

Compound Name(3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid
PubChem CID15693863
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Name(3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid
SMILESCC1=C(C(=O)O)C(C)(C)CC[C@H]1O
InChIInChI=1S/C10H16O3/c1-6-7(11)4-5-10(2,3)8(6)9(12)13/h7,11H,4-5H2,1-3H3,(H,12,13)/t7-/m1/s1
InChIKeyIJTFWVKHFTZVSR-SSDOTTSWSA-N
XLogP1.57
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 51.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid?
The IUPAC name of (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid (CID 15693863) is (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid.
What is the SMILES notation for (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid?
The canonical SMILES for (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid is CC1=C(C(=O)O)C(C)(C)CC[C@H]1O.
What is the InChIKey of (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid?
The InChIKey is IJTFWVKHFTZVSR-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H16O3/c1-6-7(11)4-5-10(2,3)8(6)9(12)13/h7,11H,4-5H2,1-3H3,(H,12,13)/t7-/m1/s1.
What are the key properties of (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid?
(3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid has a molecular weight of 184.23 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid is sourced from PubChem (CID 15693863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).