C19H24O2 — CID 15694187
(3S,5S)-1,7-diphenylheptane-3,5-diol (PubChem CID 15694187) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (3S,5S)-1,7-diphenylheptane-3,5-diol.
| Compound Name | (3S,5S)-1,7-diphenylheptane-3,5-diol |
|---|---|
| PubChem CID | 15694187 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (3S,5S)-1,7-diphenylheptane-3,5-diol |
| SMILES | O[C@@H](CCc1ccccc1)C[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C19H24O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-10,18-21H,11-15H2/t18-,19-/m0/s1 |
| InChIKey | QSUSPILNZCEGPK-OALUTQOASA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |