About tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane
tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane (PubChem CID 15694476) has the molecular formula C19H40O2Sn
and a molecular weight of 419.24 g/mol. Its IUPAC name is tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane.
Molecular Properties
| Compound Name | tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane |
| PubChem CID | 15694476 |
| Molecular Formula | C19H40O2Sn |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane |
| SMILES | CC/C=C/[C@@H](OCOC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C7H13O2.3C4H9.Sn/c1-3-4-5-6-9-7-8-2;3*1-3-4-2;/h4-6H,3,7H2,1-2H3;3*1,3-4H2,2H3;/b5-4+;;;; |
| InChIKey | ZKBCRNOQUMZYMZ-ZIDOSWBXSA-N |
| XLogP | 6.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane?
The IUPAC name of tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane (CID 15694476) is tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane.
What is the SMILES notation for tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane?
The canonical SMILES for tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane is CC/C=C/[C@@H](OCOC)[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane?
The InChIKey is ZKBCRNOQUMZYMZ-ZIDOSWBXSA-N. The full InChI is InChI=1S/C7H13O2.3C4H9.Sn/c1-3-4-5-6-9-7-8-2;3*1-3-4-2;/h4-6H,3,7H2,1-2H3;3*1,3-4H2,2H3;/b5-4+;;;;.
What are the key properties of tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane?
tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane has a molecular weight of 419.24 g/mol, XLogP of 6.33, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(E,1S)-1-(methoxymethoxy)pent-2-enyl]stannane is sourced from PubChem (CID 15694476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).