C21H52O6Si5 — CID 15695113
(2S,3S,4R,5R)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanal (PubChem CID 15695113) has the molecular formula C21H52O6Si5 and a molecular weight of 541.07 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanal.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanal |
|---|---|
| PubChem CID | 15695113 |
| Molecular Formula | C21H52O6Si5 |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanal |
| SMILES | C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H52O6Si5/c1-28(2,3)23-17-19(25-30(7,8)9)21(27-32(13,14)15)20(26-31(10,11)12)18(16-22)24-29(4,5)6/h16,18-21H,17H2,1-15H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | PPTMWEDTYQRQBC-XRXFAXGQSA-N |
| XLogP | 5.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|