C23H40O2Si — CID 15695162
(1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-15,15-dimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one (PubChem CID 15695162) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-15,15-dimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one.
| Compound Name | (1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-15,15-dimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one |
|---|---|
| PubChem CID | 15695162 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-15,15-dimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one |
| SMILES | CC1(C)/C2=C/C[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@H]3C(=O)C[C@H]1CC2 |
| InChI | InChI=1S/C23H40O2Si/c1-22(2,3)26(6,7)25-21-10-8-9-18-19(21)14-13-16-11-12-17(15-20(18)24)23(16,4)5/h13,17-19,21H,8-12,14-15H2,1-7H3/b16-13-/t17-,18-,19-,21-/m1/s1 |
| InChIKey | PPYJLHCURJXXBS-DXICZVNESA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|