C23H56Si6 — CID 15695361
bis(trimethylsilyl)methyl-[[1,1-dimethyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl]-dimethylsilane (PubChem CID 15695361) has the molecular formula C23H56Si6 and a molecular weight of 501.22 g/mol. Its IUPAC name is bis(trimethylsilyl)methyl-[[1,1-dimethyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl]-dimethylsilane.
| Compound Name | bis(trimethylsilyl)methyl-[[1,1-dimethyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 15695361 |
| Molecular Formula | C23H56Si6 |
| Molecular Weight | 501.22 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | bis(trimethylsilyl)methyl-[[1,1-dimethyl-6,6-bis(trimethylsilyl)-2,5-dihydrosilin-3-yl]methyl]-dimethylsilane |
| SMILES | C[Si](C)(C)C([Si](C)(C)C)[Si](C)(C)CC1=CCC([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C1 |
| InChI | InChI=1S/C23H56Si6/c1-24(2,3)22(25(4,5)6)28(13,14)19-21-17-18-23(26(7,8)9,27(10,11)12)29(15,16)20-21/h17,22H,18-20H2,1-16H3 |
| InChIKey | DUMCOUYSJZDBKX-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.22 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|