C17H15Cl2N3O — CID 15695437
1-(4-chlorophenyl)-N-[2-[5-(4-chlorophenyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]ethyl]methanimine (PubChem CID 15695437) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[5-(4-chlorophenyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]ethyl]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[5-(4-chlorophenyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]ethyl]methanimine |
|---|---|
| PubChem CID | 15695437 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[5-(4-chlorophenyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]ethyl]methanimine |
| SMILES | Clc1ccc(/C=N/CCC2=NC(c3ccc(Cl)cc3)ON2)cc1 |
| InChI | InChI=1S/C17H15Cl2N3O/c18-14-5-1-12(2-6-14)11-20-10-9-16-21-17(23-22-16)13-3-7-15(19)8-4-13/h1-8,11,17H,9-10H2,(H,21,22)/b20-11+ |
| InChIKey | HGJSPWOIHVLENW-RGVLZGJSSA-N |
| XLogP | 4.43 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|