C19H16Cl2O2 — CID 15695495
1-[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-yl]ethanone (PubChem CID 15695495) has the molecular formula C19H16Cl2O2 and a molecular weight of 347.24 g/mol. Its IUPAC name is 1-[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-yl]ethanone.
| Compound Name | 1-[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-yl]ethanone |
|---|---|
| PubChem CID | 15695495 |
| Molecular Formula | C19H16Cl2O2 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 1-[2,2-bis(4-chlorophenyl)-5-methyl-3H-furan-4-yl]ethanone |
| SMILES | CC(=O)C1=C(C)OC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H16Cl2O2/c1-12(22)18-11-19(23-13(18)2,14-3-7-16(20)8-4-14)15-5-9-17(21)10-6-15/h3-10H,11H2,1-2H3 |
| InChIKey | SDGLMBCYYCHMJJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |