C10H15ClO2 — CID 15695813
4-(chloromethyl)-2-methyl-2-[(1E,3E)-penta-1,3-dienyl]-1,3-dioxolane (PubChem CID 15695813) has the molecular formula C10H15ClO2 and a molecular weight of 202.68 g/mol. Its IUPAC name is 4-(chloromethyl)-2-methyl-2-[(1E,3E)-penta-1,3-dienyl]-1,3-dioxolane.
| Compound Name | 4-(chloromethyl)-2-methyl-2-[(1E,3E)-penta-1,3-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 15695813 |
| Molecular Formula | C10H15ClO2 |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-(chloromethyl)-2-methyl-2-[(1E,3E)-penta-1,3-dienyl]-1,3-dioxolane |
| SMILES | C/C=C/C=C/C1(C)OCC(CCl)O1 |
| InChI | InChI=1S/C10H15ClO2/c1-3-4-5-6-10(2)12-8-9(7-11)13-10/h3-6,9H,7-8H2,1-2H3/b4-3+,6-5+ |
| InChIKey | IHZCVCARPKNPNY-VNKDHWASSA-N |
| XLogP | 2.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|