C25H46NO2+ — CID 156960908
2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxyethyl-trimethylazanium (PubChem CID 156960908) has the molecular formula C25H46NO2+ and a molecular weight of 392.65 g/mol. Its IUPAC name is 2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156960908 |
| Molecular Formula | C25H46NO2+ |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 392.35 |
| IUPAC Name | 2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C25H46NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(27)28-24-23-26(2,3)4/h9-10,12-13,15-16H,5-8,11,14,17-24H2,1-4H3/q+1/b10-9-,13-12-,16-15- |
| InChIKey | CPIZQONKXRTJBX-YOILPLPUSA-N |
| XLogP | 6.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|