C16H18N2O2 — CID 15696216
2-[(2R,3R)-3-(2-hydroxyphenyl)piperazin-2-yl]phenol (PubChem CID 15696216) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[(2R,3R)-3-(2-hydroxyphenyl)piperazin-2-yl]phenol.
| Compound Name | 2-[(2R,3R)-3-(2-hydroxyphenyl)piperazin-2-yl]phenol |
|---|---|
| PubChem CID | 15696216 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[(2R,3R)-3-(2-hydroxyphenyl)piperazin-2-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1NCCN[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C16H18N2O2/c19-13-7-3-1-5-11(13)15-16(18-10-9-17-15)12-6-2-4-8-14(12)20/h1-8,15-20H,9-10H2/t15-,16-/m1/s1 |
| InChIKey | KERNBIPDYLKESH-HZPDHXFCSA-N |
| XLogP | 2.07 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|