C20H26N2O2 — CID 15696222
2-[(2R,3R,5S)-3-(2-hydroxyphenyl)-5-(2-methylpropyl)piperazin-2-yl]phenol (PubChem CID 15696222) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[(2R,3R,5S)-3-(2-hydroxyphenyl)-5-(2-methylpropyl)piperazin-2-yl]phenol.
| Compound Name | 2-[(2R,3R,5S)-3-(2-hydroxyphenyl)-5-(2-methylpropyl)piperazin-2-yl]phenol |
|---|---|
| PubChem CID | 15696222 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-[(2R,3R,5S)-3-(2-hydroxyphenyl)-5-(2-methylpropyl)piperazin-2-yl]phenol |
| SMILES | CC(C)C[C@H]1CN[C@H](c2ccccc2O)[C@@H](c2ccccc2O)N1 |
| InChI | InChI=1S/C20H26N2O2/c1-13(2)11-14-12-21-19(15-7-3-5-9-17(15)23)20(22-14)16-8-4-6-10-18(16)24/h3-10,13-14,19-24H,11-12H2,1-2H3/t14-,19+,20+/m0/s1 |
| InChIKey | QZYKLMHERNXDKT-VHKYSDTDSA-N |
| XLogP | 3.49 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|