About N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline
N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 15696371) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| PubChem CID | 15696371 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | COc1cc(/C=C/c2ccc(N(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO3/c1-20(2)16-10-8-14(9-11-16)6-7-15-12-17(21-3)19(23-5)18(13-15)22-4/h6-13H,1-5H3/b7-6+ |
| InChIKey | PHDDAWSHQWUPPP-VOTSOKGWSA-N |
| XLogP | 3.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
The IUPAC name of N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (CID 15696371) is N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
What is the SMILES notation for N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
The canonical SMILES for N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline is COc1cc(/C=C/c2ccc(N(C)C)cc2)cc(OC)c1OC.
What is the InChIKey of N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
The InChIKey is PHDDAWSHQWUPPP-VOTSOKGWSA-N. The full InChI is InChI=1S/C19H23NO3/c1-20(2)16-10-8-14(9-11-16)6-7-15-12-17(21-3)19(23-5)18(13-15)22-4/h6-13H,1-5H3/b7-6+.
What are the key properties of N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline has a molecular weight of 313.40 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline is sourced from PubChem (CID 15696371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).