About 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane
3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane (PubChem CID 15696438) has the molecular formula C20H24OS
and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane.
Molecular Properties
| Compound Name | 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane |
| PubChem CID | 15696438 |
| Molecular Formula | C20H24OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane |
| SMILES | CSC1OC(c2ccccc2)(c2ccccc2)C1C(C)(C)C |
| InChI | InChI=1S/C20H24OS/c1-19(2,3)17-18(22-4)21-20(17,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17-18H,1-4H3 |
| InChIKey | KELSLVFAAMDZEE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane?
The IUPAC name of 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane (CID 15696438) is 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane.
What is the SMILES notation for 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane?
The canonical SMILES for 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane is CSC1OC(c2ccccc2)(c2ccccc2)C1C(C)(C)C.
What is the InChIKey of 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane?
The InChIKey is KELSLVFAAMDZEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24OS/c1-19(2,3)17-18(22-4)21-20(17,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17-18H,1-4H3.
What are the key properties of 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane?
3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane has a molecular weight of 312.48 g/mol, XLogP of 5.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-methylsulfanyl-2,2-diphenyloxetane is sourced from PubChem (CID 15696438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).