C43H72NO9P — CID 156964981
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (5Z,8Z,10E,12R,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate (PubChem CID 156964981) has the molecular formula C43H72NO9P and a molecular weight of 778.02 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (5Z,8Z,10E,12R,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (5Z,8Z,10E,12R,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156964981 |
| Molecular Formula | C43H72NO9P |
| Molecular Weight | 778.02 g/mol |
| Exact Mass | 777.49 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropyl] (5Z,8Z,10E,12R,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C=C\[C@H](O)C/C=C\CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H72NO9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-23-27-31-35-43(47)53-41(39-52-54(48,49)51-37-36-44)38-50-42(46)34-30-26-22-20-19-21-25-29-33-40(45)32-28-24-10-8-6-4-2/h5,7,11-12,14-15,20-22,24-25,28-29,33,40-41,45H,3-4,6,8-10,13,16-19,23,26-27,30-32,34-39,44H2,1-2H3,(H,48,49)/b7-5-,12-11-,15-14-,22-20-,25-21-,28-24-,33-29+/t40-,41-/m1/s1 |
| InChIKey | SENGLTADJCTJRU-DGCVAATISA-N |
| XLogP | 10.24 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.02 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|