(3S)-4-amino-3-(furan-2-yl)butanoic acid

C8H11NO3 — CID 15696510

IUPAC(3S)-4-amino-3-(furan-2-yl)butanoic acid
SMILESNC[C@H](CC(=O)O)c1ccco1
InChIInChI=1S/C8H11NO3/c9-5-6(4-8(10)11)7-2-1-3-12-7/h1-3,6H,4-5,9H2,(H,10,11)/t6-/m0/s1
InChIKeyPNVONHQAGBQVCW-LURJTMIESA-N
MW169.18 g/mol
LogP0.80
Rot. Bonds4

About (3S)-4-amino-3-(furan-2-yl)butanoic acid

(3S)-4-amino-3-(furan-2-yl)butanoic acid (PubChem CID 15696510) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is (3S)-4-amino-3-(furan-2-yl)butanoic acid.

Molecular Properties

Compound Name(3S)-4-amino-3-(furan-2-yl)butanoic acid
PubChem CID15696510
Molecular FormulaC8H11NO3
Molecular Weight169.18 g/mol
Exact Mass169.07
IUPAC Name(3S)-4-amino-3-(furan-2-yl)butanoic acid
SMILESNC[C@H](CC(=O)O)c1ccco1
InChIInChI=1S/C8H11NO3/c9-5-6(4-8(10)11)7-2-1-3-12-7/h1-3,6H,4-5,9H2,(H,10,11)/t6-/m0/s1
InChIKeyPNVONHQAGBQVCW-LURJTMIESA-N
XLogP0.80
TPSA76.46 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 50.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3S)-4-amino-3-(furan-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-4-amino-3-(furan-2-yl)butanoic acid?
The IUPAC name of (3S)-4-amino-3-(furan-2-yl)butanoic acid (CID 15696510) is (3S)-4-amino-3-(furan-2-yl)butanoic acid.
What is the SMILES notation for (3S)-4-amino-3-(furan-2-yl)butanoic acid?
The canonical SMILES for (3S)-4-amino-3-(furan-2-yl)butanoic acid is NC[C@H](CC(=O)O)c1ccco1.
What is the InChIKey of (3S)-4-amino-3-(furan-2-yl)butanoic acid?
The InChIKey is PNVONHQAGBQVCW-LURJTMIESA-N. The full InChI is InChI=1S/C8H11NO3/c9-5-6(4-8(10)11)7-2-1-3-12-7/h1-3,6H,4-5,9H2,(H,10,11)/t6-/m0/s1.
What are the key properties of (3S)-4-amino-3-(furan-2-yl)butanoic acid?
(3S)-4-amino-3-(furan-2-yl)butanoic acid has a molecular weight of 169.18 g/mol, XLogP of 0.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-amino-3-(furan-2-yl)butanoic acid is sourced from PubChem (CID 15696510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).