C45H80NO9P — CID 156965282
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 156965282) has the molecular formula C45H80NO9P and a molecular weight of 810.11 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156965282 |
| Molecular Formula | C45H80NO9P |
| Molecular Weight | 810.11 g/mol |
| Exact Mass | 809.56 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCC[C@H](C)O |
| InChI | InChI=1S/C45H80NO9P/c1-3-4-5-6-7-8-9-10-11-12-15-18-21-24-27-30-33-36-44(48)52-40-43(41-54-56(50,51)53-39-38-46)55-45(49)37-34-31-28-25-22-19-16-13-14-17-20-23-26-29-32-35-42(2)47/h10-11,14,16-17,19,23,25-26,28,42-43,47H,3-9,12-13,15,18,20-22,24,27,29-41,46H2,1-2H3,(H,50,51)/b11-10-,17-14-,19-16-,26-23-,28-25-/t42-,43+/m0/s1 |
| InChIKey | XWFRCWCRBUJBRM-IVCWCTIXSA-N |
| XLogP | 11.47 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.11 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|