C43H74NO9P — CID 156965747
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 156965747) has the molecular formula C43H74NO9P and a molecular weight of 780.04 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156965747 |
| Molecular Formula | C43H74NO9P |
| Molecular Weight | 780.04 g/mol |
| Exact Mass | 779.51 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCC1OC1C/C=C\CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H74NO9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-25-30-34-43(46)52-39(38-51-54(47,48)50-36-35-44)37-49-42(45)33-29-26-22-24-28-32-41-40(53-41)31-27-23-10-8-6-4-2/h11-12,14-15,17-18,20-21,23,27,39-41H,3-10,13,16,19,22,24-26,28-38,44H2,1-2H3,(H,47,48)/b12-11-,15-14-,18-17-,21-20-,27-23-/t39-,40?,41?/m1/s1 |
| InChIKey | CLIHPKSCAWRNOT-FFURDIABSA-N |
| XLogP | 10.70 |
| TPSA | 146.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.04 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|