2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid

C7H11NO2 — CID 15696614

IUPAC2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid
SMILESCC1CC=C(C(=O)O)CN1
InChIInChI=1S/C7H11NO2/c1-5-2-3-6(4-8-5)7(9)10/h3,5,8H,2,4H2,1H3,(H,9,10)
InChIKeyRCJYULBNWWVJML-UHFFFAOYSA-N
MW141.17 g/mol
LogP0.38
Rot. Bonds1

About 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid

2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid (PubChem CID 15696614) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid.

Molecular Properties

Compound Name2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid
PubChem CID15696614
Molecular FormulaC7H11NO2
Molecular Weight141.17 g/mol
Exact Mass141.08
IUPAC Name2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid
SMILESCC1CC=C(C(=O)O)CN1
InChIInChI=1S/C7H11NO2/c1-5-2-3-6(4-8-5)7(9)10/h3,5,8H,2,4H2,1H3,(H,9,10)
InChIKeyRCJYULBNWWVJML-UHFFFAOYSA-N
XLogP0.38
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 50.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid?
The IUPAC name of 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid (CID 15696614) is 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid.
What is the SMILES notation for 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid?
The canonical SMILES for 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid is CC1CC=C(C(=O)O)CN1.
What is the InChIKey of 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid?
The InChIKey is RCJYULBNWWVJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-5-2-3-6(4-8-5)7(9)10/h3,5,8H,2,4H2,1H3,(H,9,10).
What are the key properties of 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid?
2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid has a molecular weight of 141.17 g/mol, XLogP of 0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2,3,6-tetrahydropyridine-5-carboxylic acid is sourced from PubChem (CID 15696614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).