About 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one
5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one (PubChem CID 15696723) has the molecular formula C14H9FN2O
and a molecular weight of 240.24 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one |
| PubChem CID | 15696723 |
| Molecular Formula | C14H9FN2O |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one |
| SMILES | O=c1ccc2c(-c3ccc(F)cc3)nccc2[nH]1 |
| InChI | InChI=1S/C14H9FN2O/c15-10-3-1-9(2-4-10)14-11-5-6-13(18)17-12(11)7-8-16-14/h1-8H,(H,17,18) |
| InChIKey | CVXFNDOAPZULEK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one?
The IUPAC name of 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one (CID 15696723) is 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one.
What is the SMILES notation for 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one?
The canonical SMILES for 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one is O=c1ccc2c(-c3ccc(F)cc3)nccc2[nH]1.
What is the InChIKey of 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one?
The InChIKey is CVXFNDOAPZULEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN2O/c15-10-3-1-9(2-4-10)14-11-5-6-13(18)17-12(11)7-8-16-14/h1-8H,(H,17,18).
What are the key properties of 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one?
5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one has a molecular weight of 240.24 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-1H-1,6-naphthyridin-2-one is sourced from PubChem (CID 15696723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).