C43H69O9P — CID 156968605
[(2R)-1-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 156968605) has the molecular formula C43H69O9P and a molecular weight of 760.99 g/mol. Its IUPAC name is [(2R)-1-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156968605 |
| Molecular Formula | C43H69O9P |
| Molecular Weight | 760.99 g/mol |
| Exact Mass | 760.47 |
| IUPAC Name | [(2R)-1-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\[C@H](O)CCCC |
| InChI | InChI=1S/C43H69O9P/c1-3-5-7-8-9-10-11-12-13-14-15-16-20-23-26-29-32-36-42(45)50-38-41(39-51-53(47,48)49)52-43(46)37-33-30-27-24-21-18-17-19-22-25-28-31-35-40(44)34-6-4-2/h5,7,9-10,12-13,15-18,22,24-25,27,31,35,40-41,44H,3-4,6,8,11,14,19-21,23,26,28-30,32-34,36-39H2,1-2H3,(H2,47,48,49)/b7-5-,10-9-,13-12-,16-15-,18-17-,25-22-,27-24-,35-31-/t40-,41-/m1/s1 |
| InChIKey | AVDRBXFLJMJGGW-SLTUKVMXSA-N |
| XLogP | 10.81 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.99 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|