C45H73O9P — CID 156969219
[(2R)-1-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate (PubChem CID 156969219) has the molecular formula C45H73O9P and a molecular weight of 789.04 g/mol. Its IUPAC name is [(2R)-1-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate.
| Compound Name | [(2R)-1-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 156969219 |
| Molecular Formula | C45H73O9P |
| Molecular Weight | 789.04 g/mol |
| Exact Mass | 788.50 |
| IUPAC Name | [(2R)-1-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCO)COP(=O)(O)O |
| InChI | InChI=1S/C45H73O9P/c1-2-3-4-5-6-7-8-9-10-11-12-14-18-21-24-27-30-33-36-39-45(48)54-43(42-53-55(49,50)51)41-52-44(47)38-35-32-29-26-23-20-17-15-13-16-19-22-25-28-31-34-37-40-46/h6-7,9-10,12-14,16-17,20-22,24-26,29,43,46H,2-5,8,11,15,18-19,23,27-28,30-42H2,1H3,(H2,49,50,51)/b7-6-,10-9-,14-12-,16-13-,20-17-,24-21-,25-22-,29-26-/t43-/m1/s1 |
| InChIKey | AWTRRIUBENCQSP-VNCIJQHPSA-N |
| XLogP | 11.59 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.04 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|