C39H68NO11PS — CID 156970181
(5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl]oxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid (PubChem CID 156970181) has the molecular formula C39H68NO11PS and a molecular weight of 790.01 g/mol. Its IUPAC name is (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl]oxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid.
| Compound Name | (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl]oxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 156970181 |
| Molecular Formula | C39H68NO11PS |
| Molecular Weight | 790.01 g/mol |
| Exact Mass | 789.43 |
| IUPAC Name | (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-[(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl]oxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)O[C@H](COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C39H68NO11PS/c1-4-6-7-8-9-10-11-12-13-14-18-21-26-36(35(41)25-23-27-37(42)43)53-31-34(40)39(45)51-33(30-50-52(46,47)48)29-49-38(44)28-22-19-16-15-17-20-24-32(3)5-2/h9-10,12-14,18,21,26,32-36,41H,4-8,11,15-17,19-20,22-25,27-31,40H2,1-3H3,(H,42,43)(H2,46,47,48)/b10-9-,13-12-,18-14+,26-21+/t32?,33-,34+,35+,36-/m1/s1 |
| InChIKey | JGFCTIXIJVLELZ-KBKVZXJKSA-N |
| XLogP | 7.96 |
| TPSA | 202.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.01 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|