C33H59O9P — CID 156970756
[(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate (PubChem CID 156970756) has the molecular formula C33H59O9P and a molecular weight of 630.80 g/mol. Its IUPAC name is [(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate.
| Compound Name | [(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
|---|---|
| PubChem CID | 156970756 |
| Molecular Formula | C33H59O9P |
| Molecular Weight | 630.80 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | [(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C33H59O9P/c1-4-5-6-7-8-13-18-23-30(34)24-19-14-11-16-20-25-32(35)40-27-31(28-41-43(37,38)39)42-33(36)26-21-15-10-9-12-17-22-29(2)3/h5-6,8,13,18,23,29-31,34H,4,7,9-12,14-17,19-22,24-28H2,1-3H3,(H2,37,38,39)/b6-5+,13-8+,23-18+/t30?,31-/m1/s1 |
| InChIKey | PSBIAPQFYNFRKH-FXJJMODTSA-N |
| XLogP | 7.89 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.80 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|